1H-PERFLUOROOCTANE manufacturers
- 1H-perfluorooctane
-
- $0.00 / 1KG
-
2026-01-20
- CAS:335-65-9
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- 1H perfluorooctane
-
- $0.00 / 20KG
-
2025-11-29
- CAS:335-65-9
- Min. Order: 2000KG
- Purity: 99.9%
- Supply Ability: 20tons
- 1H-PERFLUOROOCTANE
-
- $100.00 / 1KG
-
2025-09-25
- CAS:335-65-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1H-PERFLUOROOCTANE Basic information |
| Product Name: | 1H-PERFLUOROOCTANE | | Synonyms: | 1H-PERFLUOROOCTANE;8-acetyl-3-phenothiazinone;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUOROOCTANE;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUOROOCTANE 99%;1H-Perfluorooctane 98%;1H-Perfluorooctane98%;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctane;1-Hydroperfluorooctane | | CAS: | 335-65-9 | | MF: | C8HF17 | | MW: | 420.07 | | EINECS: | 206-395-8 | | Product Categories: | Alkyl;Building Blocks;Chemical Synthesis;Halogenated Hydrocarbons;Organic Building Blocks | | Mol File: | 335-65-9.mol |  |
| | 1H-PERFLUOROOCTANE Chemical Properties |
| Boiling point | 118 °C(lit.) | | density | 1.758 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.300(lit.) | | Fp | >230 °F | | InChI | InChI=1S/C8HF17/c9-1(10)2(11,12)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)25/h1H | | InChIKey | KBHBUUBXEQUIMV-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F | | CAS DataBase Reference | 335-65-9(CAS DataBase Reference) | | EPA Substance Registry System | 8H-Perfluorooctane (335-65-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29033990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1H-PERFLUOROOCTANE Usage And Synthesis |
| Chemical Properties | Clear colorless liquid |
| | 1H-PERFLUOROOCTANE Preparation Products And Raw materials |
|