N-ALPHA-ACETYL-L-ORNITHINE manufacturers
- N-Acetylornithine
-
- $49.00 / 50mg
-
2026-03-13
- CAS:6205-08-9
- Min. Order:
- Purity: 99.86%
- Supply Ability: 10g
|
| | N-ALPHA-ACETYL-L-ORNITHINE Basic information |
| | N-ALPHA-ACETYL-L-ORNITHINE Chemical Properties |
| Melting point | 204-205oC | | Boiling point | 436.2±40.0 °C(Predicted) | | density | 1.171±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Aqueous Acid (Sparingly, Sonicated), Aqueous Base (Sparingly), Water (Sparingly) | | form | Solid | | pka | 3.41±0.10(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | 1S/C7H14N2O3/c1-5(10)9-6(7(11)12)3-2-4-8/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1 | | InChIKey | JRLGPAXAGHMNOL-LURJTMIESA-N | | SMILES | CC(=O)N[C@@H](CCCN)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-ALPHA-ACETYL-L-ORNITHINE Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | Nα-Acetyl-L-ornithine is used in the identification of type 2 diabetes group through topological analysis of patient similarity. | | Definition | ChEBI: An N2-acyl-L-ornithine where the acyl group is specified to be acetyl. | | Biochem/physiol Actions | Nα-Acetyl-L-ornithine (AORN) is a substrate for the identification, differentiation and characterization of N(α)-acetyl-L-ornithine deacetylase(s) and of N-Acetyl-l-ornithine transcarbamylase(s) (AOTCase) found in plants, some eubacteria and some human pathogens. |
| | N-ALPHA-ACETYL-L-ORNITHINE Preparation Products And Raw materials |
|