|
|
| | 2,4-Bis(trifluoromethyl)benzyl bromide Basic information |
| Product Name: | 2,4-Bis(trifluoromethyl)benzyl bromide | | Synonyms: | 2,4-DI(TRIFLUOROMETHYL)BENZYL BROMIDE;2,4-BIS(TRIFLUOROMETHYL)BENZYL BROMIDE;1-(BROMOMETHYL)-2,4-BIS(TRIFLUOROMETHYL)BENZENE;2,4-Bis(trifluoromethyl)benzyl bromide, 97+%;Benzene, 1-(bromomethyl)-2,4-bis(trifluoromethyl)-;2,4-Bis(trifluoromethyl)benzyl bromide 98%;2,4-Bis(trifluoromethyl)benzylbromide98%;177256 | | CAS: | 140690-56-8 | | MF: | C9H5BrF6 | | MW: | 307.03 | | EINECS: | 628-148-7 | | Product Categories: | Fluorine series | | Mol File: | 140690-56-8.mol |  |
| | 2,4-Bis(trifluoromethyl)benzyl bromide Chemical Properties |
| Boiling point | 112°C 0,2mm | | density | 1.637 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.451(lit.) | | Fp | 130 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Liquid | | Specific Gravity | 1.637 | | color | Clear colorless to pale yellow | | Sensitive | Lachrymatory | | BRN | 7995492 | | InChI | 1S/C9H5BrF6/c10-4-5-1-2-6(8(11,12)13)3-7(5)9(14,15)16/h1-3H,4H2 | | InChIKey | SWFFFUJOWAJJCH-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(CBr)c(c1)C(F)(F)F | | CAS DataBase Reference | 140690-56-8(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4-Bis(trifluoromethyl)benzyl bromide(140690-56-8) |
| Hazard Codes | C | | Risk Statements | 10-34 | | Safety Statements | 16-26-27-36/37/39-45 | | RIDADR | UN 2920 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3
Skin Corr. 1B |
| | 2,4-Bis(trifluoromethyl)benzyl bromide Usage And Synthesis |
| Uses | 2,4-Bis(trifluoromethyl)benzyl bromide may be used in chemical synthesis studies. | | Uses | 2,4-Bis(trifluoromethyl)benzyl Bromide (CAS# 140690-56-8) can be used to cure elastomers with the use of inducers. |
| | 2,4-Bis(trifluoromethyl)benzyl bromide Preparation Products And Raw materials |
|