|
|
| | 2-Bromo-4-fluorobenzaldehyde Basic information |
| | 2-Bromo-4-fluorobenzaldehyde Chemical Properties |
| Melting point | 61.5 | | Boiling point | 234.9±20.0 °C(Predicted) | | density | 1.70 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C7H4BrFO/c8-7-3-6(9)2-1-5(7)4-10/h1-4H | | InChIKey | OPZDXMCOWFPQPE-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(F)C=C1Br | | CAS DataBase Reference | 59142-68-6(CAS DataBase Reference) |
| | 2-Bromo-4-fluorobenzaldehyde Usage And Synthesis |
| Chemical Properties | White to light yellow solid | | Uses | 2-Bromo-4-fluorobenzaldehyde used as pharmaceutical intermediates.It could be the starting material to synthesise 2-Bromo-4-fluorobenzonitrile, 6-Fluoroisobenzofuran-1(3H)-one, etc. | | Synthesis | The general procedure for the synthesis of 2-bromo-4-fluorobenzaldehyde from 2-bromo-4-fluorobenzyl alcohol was as follows: benzyl alcohol substrate (0.2 mmol), FeCl3-6H2O (0.002 mmol, 5.4 mg) and triphenylmethanol (0.2 mmol, 52 mg) were mixed in a dry reaction vessel. Subsequently, the reaction mixture was irradiated in a microwave reactor at 55 °C for 1 hour. Upon completion of the reaction, the crude product was purified by fast column chromatography to afford the target product 2-bromo-4-fluorobenzaldehyde. | | References | [1] Tetrahedron, 2015, vol. 71, # 38, p. 6744 - 6748
[2] Synthesis (Germany), 2013, vol. 45, # 24, p. 3387 - 3391 |
| | 2-Bromo-4-fluorobenzaldehyde Preparation Products And Raw materials |
|