| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | Boc-(S)-alpha-(4-tert-butyl-benzyl)-proline Basic information |
| Product Name: | Boc-(S)-alpha-(4-tert-butyl-benzyl)-proline | | Synonyms: | BOC-ALPHA-(4-TERT-BUTYLBENZYL)-D-PROLINE;BOC-(S)-ALPHA-(4-TERT-BUTYLBENZYL)-PRO-OH;(S)-1-BOC-2-(4-TERT-BUTYLBENZYL)-2-PYRROLIDINECARBOXYLIC ACID;Boc-(S)-a-(4-tert-butylbenzyl)proline;Boc-(S)-α-(4-tert-butylbenzyl)-Pro-OH;Boc-α-(4-tert-butylbenzyl)-D-proline, (S)-1-Boc-2-(4-tert-butylbenzyl)-2-pyrrolidinecarboxylic acid;Boc-(S)-alpha-(4-tert-butylphenyl)-proline;(Tert-Butoxy)Carbonyl (S)-Alpha-(4-tert-Butyl-benzyl)-Pro | | CAS: | 1217855-87-2 | | MF: | C21H31NO4 | | MW: | 361.48 | | EINECS: | | | Product Categories: | Alpha-Substituted Proline Analogs | | Mol File: | Mol File |  |
| | Boc-(S)-alpha-(4-tert-butyl-benzyl)-proline Chemical Properties |
| Boiling point | 480.4±38.0 °C(Predicted) | | density | 1.120±0.06 g/cm3(Predicted) | | pka | 3.98±0.20(Predicted) | | Major Application | peptide synthesis | | InChI | 1S/C21H31NO4/c1-19(2,3)16-10-8-15(9-11-16)14-21(17(23)24)12-7-13-22(21)18(25)26-20(4,5)6/h8-11H,7,12-14H2,1-6H3,(H,23,24)/t21-/m0/s1 | | InChIKey | BOEGKJLPJARVIT-NRFANRHFSA-N | | SMILES | CC(C)(C)OC(=O)N1CCC[C@]1(Cc2ccc(cc2)C(C)(C)C)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Boc-(S)-alpha-(4-tert-butyl-benzyl)-proline Usage And Synthesis |
| | Boc-(S)-alpha-(4-tert-butyl-benzyl)-proline Preparation Products And Raw materials |
|