- l-norleucinol
-
- $9.80 / 1KG
-
2020-01-03
- CAS:80696-29-3
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | L-NORLEUCINOL Basic information |
| Product Name: | L-NORLEUCINOL | | Synonyms: | (S)-(+)-2-AMINO-1-HEXANOL;(S)-2-AMINO-1-HEXANOL;L-NORLEUCINOL;(S)-2-Amino-1-hexzanol;(2S)-2-Amino-1-hexanol;(S)-2-Amino-1-hexanol HCl;(2S)-2-aminohexan-1-ol;(S)-2-aminohexan-1-ol | | CAS: | 80696-29-3 | | MF: | C6H15NO | | MW: | 117.19 | | EINECS: | | | Product Categories: | | | Mol File: | 80696-29-3.mol |  |
| | L-NORLEUCINOL Chemical Properties |
| Melting point | 35-40 °C(lit.) | | Boiling point | 216-218 °C(lit.) | | Fp | 211 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Aqueous Acid (Slightly), Chloroform (Slightly, Sonicated), DMSO (Slightly) | | form | Solid | | color | White to Pale Yellow | | Optical Rotation | [α]20/D +14°, c = 1 in chloroform | | InChI | InChI=1S/C6H15NO/c1-2-3-4-6(7)5-8/h6,8H,2-5,7H2,1H3/t6-/m0/s1 | | InChIKey | DPEOTCPCYHSVTC-LURJTMIESA-N | | SMILES | C(O)[C@@H](N)CCCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2922190090 |
| | L-NORLEUCINOL Usage And Synthesis |
| Uses | L-Norleucinol is used as a reactant in the synthesis of novel pyrimidine TLR7/8 dual agonists to treat hepatitis B. | | Uses | (S)-(+)-2-Amino-1-hexanol can be used in one of the key synthetic steps for the synthesis of house dust mite (HDM) peptidase allergen Der p 1 inhibitors. |
| | L-NORLEUCINOL Preparation Products And Raw materials |
|