|
|
| | 3-BROMOPYRIDINE-2-CARBOXYLIC ACID Basic information | | Application |
| | 3-BROMOPYRIDINE-2-CARBOXYLIC ACID Chemical Properties |
| Melting point | 141-1440C | | Boiling point | 315.7±27.0 °C(Predicted) | | density | 1.813 | | storage temp. | Inert atmosphere,2-8°C | | form | Solid | | pka | 2.29±0.10(Predicted) | | color | Off-White | | InChI | InChI=1S/C6H4BrNO2/c7-4-2-1-3-8-5(4)6(9)10/h1-3H,(H,9,10) | | InChIKey | KBDIRPOTVAODSA-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NC=CC=C1Br | | CAS DataBase Reference | 30683-23-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 3-BROMOPYRIDINE-2-CARBOXYLIC ACID Usage And Synthesis |
| Application | Due to the excellent coordination ability of 3-bromo-2-pyridinecarboxylic acid organic ligands, research on the self-assembly of these bifunctional ligands with metals to form complexes has been frequently reported. Firstly, researchers have achieved the goal of controlling the properties of complexes by controlling the structure of both the 3-bromo-2-pyridinecarboxylic acid ligands and the complexes through preliminary structural design. Secondly, in the process of constructing complexes using 3-bromo-2-pyridinecarboxylic acid ligands, the introduction of substituents with different electronic effects through structural modification has a significant impact on the framework structure and properties of the complexes. Therefore, charge compensation during the self-assembly process needs to be considered when designing and constructing MOFs. Currently, complexes constructed from 3-bromo-2-pyridinecarboxylic acid ligands are widely used in fields such as fluorescence sensing, gas adsorption/separation, magnetism, and catalysis. | | Chemical Properties | Light yellow Cryst |
| | 3-BROMOPYRIDINE-2-CARBOXYLIC ACID Preparation Products And Raw materials |
|