- L-His.HCl
-
- $0.00/ kg
-
2026-02-02
- CAS:645-35-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | L-Histidine hydrochloride Basic information |
| | L-Histidine hydrochloride Chemical Properties |
| Melting point | 243-244 °C(Solv: ethanol (64-17-5)) | | density | 1.472[at 20℃] | | vapor pressure | 0Pa at 20℃ | | storage temp. | Inert atmosphere,2-8°C | | form | Crystalline | | color | colorless | | Water Solubility | 149.55g/L at 20℃ | | BRN | 4168261 | | Major Application | food and beverages | | Cosmetics Ingredients Functions | SKIN CONDITIONING HAIR CONDITIONING | | InChI | InChI=1/C6H9N3O2.ClH/c7-5(6(10)11)1-4-2-8-3-9-4;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H/t5-;/s3 | | InChIKey | QZNNVYOVQUKYSC-USHJBNIQNA-N | | SMILES | C(O)(=O)[C@H](CC1N=CNC=1)N.[H]Cl |&1:3,r| | | LogP | -3.32 at 25℃ | | CAS DataBase Reference | 645-35-2(CAS DataBase Reference) | | EPA Substance Registry System | L-Histidine, monohydrochloride (645-35-2) |
| RIDADR | UN 1789 8/PG 3 | | WGK Germany | 2 | | F | 10 | | TSCA | TSCA listed | | Storage Class | 8B - Non-combustible corrosive hazardous materials | | Hazard Classifications | Met. Corr. 1 |
| | L-Histidine hydrochloride Usage And Synthesis |
| Description | L-Histidine hydrochloride can undergo racemization due to heating in water, leading to the formation of DL-histidine. It can be used as a supplement in conditions of riboflavin vitamin deficiency. | | Chemical Properties | White needles, plates, or crystalline powder; slightly bitter taste. Decomp 250C. Sol in water; insol in alc, ether. | | Uses | Amino acid. | | Flammability and Explosibility | Not classified |
| | L-Histidine hydrochloride Preparation Products And Raw materials |
|