|
|
| | 4-[4-(tert-Butoxycarbonyl)piperazino]benzoic acid Basic information |
| | 4-[4-(tert-Butoxycarbonyl)piperazino]benzoic acid Chemical Properties |
| Melting point | 50 °C | | Boiling point | 476.9±40.0 °C(Predicted) | | density | 1.213±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder | | pka | 5.12±0.10(Predicted) | | color | Off-white | | InChI | 1S/C16H22N2O4/c1-16(2,3)22-15(21)18-10-8-17(9-11-18)13-6-4-12(5-7-13)14(19)20/h4-7H,8-11H2,1-3H3,(H,19,20) | | InChIKey | BEDWYXZFIYMEJG-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCN(CC1)c2ccc(cc2)C(O)=O | | CAS DataBase Reference | 162046-66-4(CAS DataBase Reference) |
| | 4-[4-(tert-Butoxycarbonyl)piperazino]benzoic acid Usage And Synthesis |
| Uses | Boc-piperazine-benzoic acid is a PROTAC linker and can be used in the synthesis of PROTACs, such as PROTAC androgen receptor (AR) degrader ARD-2128 (HY-13229)[1]. | | Synthesis | General procedure for the synthesis of tert-butyl 4-(4-carboxyphenyl)piperazine-1-carboxylate from tert-butyl 4-(4-(methoxycarbonyl)phenyl)piperazine-1-carboxylate: 4-(4-(methoxycarbonyl)phenyl)piperazine-1-carboxylic acid tert-butyl ester (3.2 g, 10 mmol) was reacted with 2M NaOH solution (50 mL) in a mixture of THF (50 mL) and EtOH ( 50 mL) in a mixed solvent and the reaction was stirred at 60 °C for 3 hours. After completion of the reaction, the reaction mixture was concentrated to give a residue. The pH of the residue was adjusted to 7 with 2M HCl solution and filtered to afford tert-butyl 4-(4-carboxyphenyl)piperazine-1-carboxylate as a white solid (3.0 g, 100% yield). | | References | [1] Han X, et al. Strategies toward Discovery of Potent and Orally Bioavailable Proteolysis Targeting Chimera Degraders of Androgen Receptor for the Treatment of Prostate Cancer. J Med Chem. 2021;64(17):12831-12854. |
| | 4-[4-(tert-Butoxycarbonyl)piperazino]benzoic acid Preparation Products And Raw materials |
|