|
|
| | 3,5-Dibromo-4-hydroxybenzoic acid Basic information |
| | 3,5-Dibromo-4-hydroxybenzoic acid Chemical Properties |
| Melting point | 271-274 °C | | Boiling point | 342.0±42.0 °C(Predicted) | | density | 2.0591 (rough estimate) | | refractive index | 1.4947 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 3.79±0.10(Predicted) | | color | White to Off-White | | BRN | 2416147 | | InChI | InChI=1S/C7H4Br2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) | | InChIKey | PHWAJJWKNLWZGJ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(Br)=C(O)C(Br)=C1 | | CAS DataBase Reference | 3337-62-0(CAS DataBase Reference) | | NIST Chemistry Reference | 3,5-Dibromo-4-hydroxybenzoic acid(3337-62-0) | | EPA Substance Registry System | Benzoic acid, 3,5-dibromo-4-hydroxy- (3337-62-0) |
| | 3,5-Dibromo-4-hydroxybenzoic acid Usage And Synthesis |
| Chemical Properties | white fluffy fine crystalline powder | | Uses | 3,5-Dibromo-4-hydroxybenzoic Acid is an intermediate used to prepare benzbromarone (B185200) which is a uricosuric agent used in the treatment of gout and hyperuricemia. | | Definition | ChEBI: A monohydroxybenzoic acid that is p-salicylic acid with bromo- substituents at C-3 and C-5 of the benzene ring. |
| | 3,5-Dibromo-4-hydroxybenzoic acid Preparation Products And Raw materials |
|