|
|
| | 5-Bromoquinazolin-6-ylthiourea Basic information |
| | 5-Bromoquinazolin-6-ylthiourea Chemical Properties |
| Melting point | 198-202°C | | Boiling point | 435.4±55.0 °C(Predicted) | | density | 1.835 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetone (Slightly, Heated), DMSO (Sparingly, Heated), Methanol (Very Slightly, Heated) | | form | Solid | | pka | 10.38±0.70(Predicted) | | color | Pale Yellow | | Major Application | pharmaceutical | | InChI | 1S/C9H7BrN4S/c10-7-5(14-9(11)15)1-2-6-8(7)13-4-3-12-6/h1-4H,(H3,11,14,15) | | InChIKey | HURGDIYVXQDVMD-UHFFFAOYSA-N | | SMILES | S=C(Nc1c(c2nccnc2cc1)Br)N |
| WGK Germany | WGK 3 | | HS Code | 2933997500 | | Storage Class | 11 - Combustible Solids |
| | 5-Bromoquinazolin-6-ylthiourea Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | 5-Bromoquinazolin-6-ylthiourea is an impurity of the antiglaucoma drug, Brimonidine (B677520). |
| | 5-Bromoquinazolin-6-ylthiourea Preparation Products And Raw materials |
|