- 2-Bromo-6-nitrophenol
-
- $100.00 / 1KG
-
2025-09-25
- CAS:13073-25-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 2-Bromo-6-nitrophenol
-
- $0.00 / 1KG
-
2025-04-04
- CAS:13073-25-1
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1Ton
|
| | 2-Bromo-6-nitrophenol Basic information |
| | 2-Bromo-6-nitrophenol Chemical Properties |
| Melting point | 66-70 °C (lit.) | | Boiling point | 227.2±20.0 °C(Predicted) | | density | 1.881±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform; Methanol | | pka | 5.36±0.24(Predicted) | | form | Solid | | color | Yellow | | InChI | InChI=1S/C6H4BrNO3/c7-4-2-1-3-5(6(4)9)8(10)11/h1-3,9H | | InChIKey | VEJSIOPQKQXJAT-UHFFFAOYSA-N | | SMILES | C1(O)=C([N+]([O-])=O)C=CC=C1Br | | CAS DataBase Reference | 13073-25-1(CAS DataBase Reference) | | EPA Substance Registry System | 2-Bromo-6-nitrophenol (13073-25-1) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 36/37-26 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 29089990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Bromo-6-nitrophenol Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 2-Bromo-6-nitrophenol is an intermediate used in the synthesis of N-Hydroxy Eltrombopag (H825795), which is a derivative compound of Eltrombopag (508000), an agonist of the Thrombopoietin (Tpo) receptor, used as treatment for thrombocytopenia. |
| | 2-Bromo-6-nitrophenol Preparation Products And Raw materials |
|