1H,1H-HEPTAFLUOROBUTYL ACRYLATE manufacturers
|
| | 1H,1H-HEPTAFLUOROBUTYL ACRYLATE Basic information |
| Product Name: | 1H,1H-HEPTAFLUOROBUTYL ACRYLATE | | Synonyms: | HEPTAFLUOROBUTYL ACRYLATE;2,2,3,3,4,4,4-HEPTAFLUOROBUTYL ACRYLATE;1H,1H-HEPTAFLUOROBUTYL ACRYLATE;1,1-DIHYDROHEPTAFLUOROBUTYL ACRYLATE;2,2,3,3,4,4,4-Heptafluorobutyl acrylate 97%;1H,1H-Heptafluorobut-1-ylacrylate97%;2,2,3,3,4,4,4-hetafluoroproyl-2-acrylate;2,2,3,3,4,4,4-heptafluorobutyl prop-2-enoate | | CAS: | 424-64-6 | | MF: | C7H5F7O2 | | MW: | 254.1 | | EINECS: | 207-036-8 | | Product Categories: | monomer;Acrylic Monomers;C6 to C7Monomers;Carbonyl Compounds;Esters;Fluorinated AcrylicsSelf Assembly&Contact Printing;Fluorine-Containing Monomers for 157 nm UV Lithography Resist PolymersPhotonic and Optical Materials;Lithography Monomers;Low Refractive Index Monomers;Waveguide Materials | | Mol File: | 424-64-6.mol |  |
| | 1H,1H-HEPTAFLUOROBUTYL ACRYLATE Chemical Properties |
| Boiling point | 120-122 °C/743 mmHg (lit.) | | density | 1.418 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.331(lit.) | | Fp | 88 °F | | storage temp. | Flammables area | | form | Liquid | | color | Clear colorless to slightly yellow | | Specific Gravity | 1.485 | | Water Solubility | Not miscible in water. | | Sensitive | Lachrymatory | | BRN | 1792520 | | InChI | InChI=1S/C7H5F7O2/c1-2-4(15)16-3-5(8,9)6(10,11)7(12,13)14/h2H,1,3H2 | | InChIKey | PLXOUIVCSUBZIX-UHFFFAOYSA-N | | SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)F)(=O)C=C | | CAS DataBase Reference | 424-64-6(CAS DataBase Reference) | | EPA Substance Registry System | 2,2,3,3,4,4,4-Heptafluorobutyl acrylate (424-64-6) |
| Hazard Codes | Xn,Xi | | Risk Statements | 10-20/21/22-36/37 | | Safety Statements | 16-26-36 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant/Lachrymatory | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29161210 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 STOT SE 3 |
| | 1H,1H-HEPTAFLUOROBUTYL ACRYLATE Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow liquid | | Uses | 2,2,3,3,4,4,4-Heptafluorobutyl acrylate is a useful fluorinated acrylate for proteomics research. It is also used as pharmaceutical intermediate. |
| | 1H,1H-HEPTAFLUOROBUTYL ACRYLATE Preparation Products And Raw materials |
|