|
|
| | N-(Diphenylmethylene)aminoacetonitrile Basic information |
| | N-(Diphenylmethylene)aminoacetonitrile Chemical Properties |
| Melting point | 83-86 °C | | Boiling point | 351.21°C (rough estimate) | | density | 1.1405 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | Inert atmosphere,2-8°C | | solubility | 95% ethanol: soluble50mg/mL, clear, colorless to faintly yellow | | form | Powder or Crystals | | pka | 1.03±0.50(Predicted) | | color | White to yellow or slightly gray | | λmax | 245nm(H2O)(lit.) | | InChI | InChI=1S/C15H12N2/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,12H2 | | InChIKey | VRLJFRODHVSTIK-UHFFFAOYSA-N | | SMILES | C(#N)C/N=C(\C1=CC=CC=C1)/C1=CC=CC=C1 |
| Provider | Language |
|
ACROS
| English |
| | N-(Diphenylmethylene)aminoacetonitrile Usage And Synthesis |
| Chemical Properties | white to slightly grey crystals or cryst. powder | | Uses | N-(Diphenylmethylene)aminoacetonitrile is a reagent forα-amino acids using transition metal catalysis. It can also be used to synthesize Cathepsin B inhibitors. | | Preparation | N-(Diphenylmethylene)aminoacetonitrile can be prepared by transimination of benzophenone imine with aminoacetonitrile hydrochloride. The crude product can often be used as it is or it can be recrystallized (Et2O/hexane or CCl4). | | storage | stable to flash chromatography and stable at rt. It is best stored under argon to avoid contact with moisture. |
| | N-(Diphenylmethylene)aminoacetonitrile Preparation Products And Raw materials |
|