|
|
| | 2,2′-Methylenebis(6-tert-butyl-4-ethylphenol) Basic information |
| | 2,2′-Methylenebis(6-tert-butyl-4-ethylphenol) Chemical Properties |
| Melting point | 119-122 °C(lit.) | | Boiling point | 458.86°C (rough estimate) | | density | 1.010 | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.4894 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 11.37±0.48(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C25H36O2/c1-9-16-11-18(22(26)20(13-16)24(3,4)5)15-19-12-17(10-2)14-21(23(19)27)25(6,7)8/h11-14,26-27H,9-10,15H2,1-8H3 | | InChIKey | GPNYZBKIGXGYNU-UHFFFAOYSA-N | | SMILES | C(C1=CC(CC)=CC(C(C)(C)C)=C1O)C1=CC(CC)=CC(C(C)(C)C)=C1O | | LogP | 8.95 at 20℃ | | CAS DataBase Reference | 88-24-4(CAS DataBase Reference) | | EPA Substance Registry System | 2,2'-Methylenebis[6-(tert-butyl)-4-ethylphenol] (88-24-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | SL9800000 | | TSCA | TSCA listed | | HS Code | 29072990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Hazardous Substances Data | 88-24-4(Hazardous Substances Data) | | Toxicity | LD50 oral in rat: > 10gm/kg |
| | 2,2′-Methylenebis(6-tert-butyl-4-ethylphenol) Usage And Synthesis |
| Uses | Antioxidant | | Flammability and Explosibility | Not classified | | Safety Profile | Poison by
intraperitoneal route. Experimental
reproductive effects. When heated to
decomposition it emits acrid smoke and
irritating fumes. |
| | 2,2′-Methylenebis(6-tert-butyl-4-ethylphenol) Preparation Products And Raw materials |
|