|
|
| | 4,4'-Dibromobenzophenone Basic information |
| Product Name: | 4,4'-Dibromobenzophenone | | Synonyms: | BIS-(4-BROMO-PHENYL)-METHANONE;Methanone,bis(4-bromophenyl)-;Methanone,bis[4-bromophenyl]-;4,4'-DBP;(4,4-dibromo-1-cyclohexa-1,5-dienyl)-phenylmethanone;2,4,5-TRICHLORONITROBENZENE PESTANAL, 25;4,4''-DIBROMOBENZOPHENONE 98+%;4,4'-dibroMotwoBenzophenone | | CAS: | 3988-03-2 | | MF: | C13H8Br2O | | MW: | 340.01 | | EINECS: | 223-632-0 | | Product Categories: | C13 to C14;Carbonyl Compounds;Ketones;Alpha sort;D;DAlphabetic;DIA - DIC;Pesticides&Metabolites;Aromatic Benzophenones & Derivatives (substituted) | | Mol File: | 3988-03-2.mol |  |
| | 4,4'-Dibromobenzophenone Chemical Properties |
| Melting point | 171-174 °C(lit.) | | Boiling point | 395°C (rough estimate) | | density | 1.6584 (rough estimate) | | refractive index | 1.5220 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Orange to Pale Brown | | Water Solubility | Soluble in ethanol, 2-propanol, acetone and toluene. Miscible with water. | | BRN | 2049958 | | InChI | InChI=1S/C13H8Br2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H | | InChIKey | LFABNOYDEODDFX-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Br)C=C1)(C1=CC=C(Br)C=C1)=O | | CAS DataBase Reference | 3988-03-2(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-37-26 | | RIDADR | UN 2811 | | WGK Germany | 3 | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids |
| | 4,4'-Dibromobenzophenone Usage And Synthesis |
| Chemical Properties | beige crystalline powde | | Uses | 4,4'-Dibromobenzophenone is used in the synthesis of high molecular weight poly(p-phenylene) derivatives through palladium-catalyzed polycondensation reaction. | | General Description | 4,4′-Dibromobenzophenone is the main degradation product of bromopropylate in honey. |
| | 4,4'-Dibromobenzophenone Preparation Products And Raw materials |
|