- Quinoclamine
-
- $30.00 / 25mg
-
2026-03-13
- CAS:2797-51-5
- Min. Order:
- Purity: 99.13%
- Supply Ability: 10g
|
| | 2-AMINO-3-CHLORO-1,4-NAPHTHOQUINONE Basic information |
| Product Name: | 2-AMINO-3-CHLORO-1,4-NAPHTHOQUINONE | | Synonyms: | ACN;3-Chloro-2-aminonaphthalene-1,4-dione;O6K;2-Amino-3-chloro-1,4-naphthoquinone,95%;ASISCHEM T86788;2-AMino-3-chloronaphthalene-1,4-dione;Ginkgolide K;06k | | CAS: | 2797-51-5 | | MF: | C10H6ClNO2 | | MW: | 207.61 | | EINECS: | 220-529-2 | | Product Categories: | | | Mol File: | 2797-51-5.mol |  |
| | 2-AMINO-3-CHLORO-1,4-NAPHTHOQUINONE Chemical Properties |
| Melting point | 198-200 °C | | Boiling point | 310℃ | | density | 1.49 | | refractive index | 1.5790 (estimate) | | Fp | 141℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | Water Solubility | Insoluble in water | | solubility | DMSO: 250 mg/mL (1204.18 mM) | | pka | 0.70±0.20(Predicted) | | form | Powder | | color | Orange | | Major Application | agriculture environmental | | InChI | 1S/C10H6ClNO2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H,12H2 | | InChIKey | OBLNWSCLAYSJJR-UHFFFAOYSA-N | | SMILES | NC1=C(Cl)C(=O)c2ccccc2C1=O | | LogP | 2.120 | | CAS DataBase Reference | 2797-51-5(CAS DataBase Reference) | | EPA Substance Registry System | 2-Amino-3-chloro-1,4-naphthoquinone (2797-51-5) |
| Hazard Codes | T,N | | Risk Statements | 36/37/38-23-22-50/53-36 | | Safety Statements | 45-37/39-26-61-60 | | RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all | | WGK Germany | 3 | | RTECS | QL7350000 | | HazardClass | 6.1 | | HS Code | 29223990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Irrit. 2 Repr. 2 Skin Sens. 1A STOT RE 2 | | Toxicity | LD50 oral in rat: 1360mg/kg |
| Provider | Language |
|
ACROS
| English |
| | 2-AMINO-3-CHLORO-1,4-NAPHTHOQUINONE Usage And Synthesis |
| Chemical Properties | Orange powder | | Uses | 2-Amino-3-chloro-1,4-naphthoquinone is a pesticide residue in crops. | | Definition | ChEBI: Quinoclamin is a member of 1,4-naphthoquinones. |
| | 2-AMINO-3-CHLORO-1,4-NAPHTHOQUINONE Preparation Products And Raw materials |
|