| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Thiourea-d4 Basic information |
| | Thiourea-d4 Chemical Properties |
| Melting point | 170-176 °C (lit.) | | InChI | 1S/CH4N2S/c2-1(3)4/h(H4,2,3,4)/i/hD4 | | InChIKey | UMGDCJDMYOKAJW-JBISRTOLSA-N | | SMILES | [2H]N([2H])C(=S)N([2H])[2H] |
| Hazard Codes | Xn,N | | Risk Statements | 51/53-40-22-63 | | Safety Statements | 22-24-36/37-61 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 2 Repr. 2 |
| | Thiourea-d4 Usage And Synthesis |
| | Thiourea-d4 Preparation Products And Raw materials |
|