|
|
| | 2,3,3-Trimethylindolenine Basic information |
| Product Name: | 2,3,3-Trimethylindolenine | | Synonyms: | 2,3,3-TriMethylindolenine (Technical Grade, contain diMer);2,3,3-Trimethyl-3H-indole;2,3,3-trimethyl-3h-indol;RARECHEM AH BS 0130;2,3,3-TRIMETHYLINDOLE;2,3,3-TRIMETHYL-INDOLENIN;2,3,3-TRIMETHYLINDOLENINE;2,3,3-Trimethylindolenine in stock Factory | | CAS: | 1640-39-7 | | MF: | C11H13N | | MW: | 159.23 | | EINECS: | 216-685-6 | | Product Categories: | Heterocycle-Indole series;Intermediates of Dyes and Pigments;Indoles and derivatives;Indole;Piperazine derivates;Indoles;bc0001 | | Mol File: | 1640-39-7.mol |  |
| | 2,3,3-Trimethylindolenine Chemical Properties |
| Melting point | 6-8°C | | Boiling point | 228-229 °C744 mm Hg(lit.) | | density | 0.992 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.549(lit.) | | Fp | 200 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in chloroform, toluene or dichlorobenzene. | | form | Liquid | | pka | 6.33±0.40(Predicted) | | color | Clear yellow to red-brown | | BRN | 119740 | | InChI | InChI=1S/C11H13N/c1-8-11(2,3)9-6-4-5-7-10(9)12-8/h4-7H,1-3H3 | | InChIKey | FLHJIAFUWHPJRT-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(C)(C)C=1C | | CAS DataBase Reference | 1640-39-7(CAS DataBase Reference) | | NIST Chemistry Reference | 3H-Indole, 2,3,3-trimethyl-(1640-39-7) | | EPA Substance Registry System | 3H-Indole, 2,3,3-trimethyl- (1640-39-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36-37/39 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 1 | | F | 10 | | TSCA | Yes | | HS Code | 29339900 |
| | 2,3,3-Trimethylindolenine Usage And Synthesis |
| Chemical Properties | clear yellow to red-brown liquid | | Uses | 2,3,3-Trimethylindolenine is an indole derivative used in the preparation of cyanine dye labelleing reagents and other imaging agents. | | Uses | It is used in synthesis of cyanine dyes. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 33, p. 4283, 1968 DOI: 10.1021/jo01275a066 |
| | 2,3,3-Trimethylindolenine Preparation Products And Raw materials |
| Raw materials | 3-Methyl-2-butanone phenyl hydrazone-->2-(2-methoxyphenyl)-2-methylpropanenitrile-->4,4-DIMETHYL-5-METHYLEN-1,3-DIOXOLANE-2-ONE-->2,4,6-TRIMETHYLBENZONITRILE-->Phenylhydrazine hydrochloride-->Aniline hydrochloride-->Methyllithium-->3-Methyl-2-butanone | | Preparation Products | 1,3,3-Trimethyl-2-methyleneindoline-->Cy3 Carboxylic acids-->1',3'-Dihydro-1',3',3'-trimethyl-6,8-dinitrospiro[2H-1-benzopyran-2,2'-[2H]indole]-->1-Benzyl-2,3,3-trimethyl-3H-indol-1-ium bromide |
|