2,5-DINITROBENZOIC ACID manufacturers
|
| | 2,5-DINITROBENZOIC ACID Basic information |
| Product Name: | 2,5-DINITROBENZOIC ACID | | Synonyms: | 2,5-DINITROBENZOIC ACID;2,5-DNBA;2,5-Dinitrobenzoic acid,98%;2,5-Dinitrobenzoic acid >=95.0% (HPLC);2,5-dinitrobenzoate;Benzoic acid, 2,5-dinitro- | | CAS: | 610-28-6 | | MF: | C7H4N2O6 | | MW: | 212.12 | | EINECS: | 210-216-9 | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;C7;Carbonyl Compounds;Carboxylic Acids;Building Blocks;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks | | Mol File: | 610-28-6.mol |  |
| | 2,5-DINITROBENZOIC ACID Chemical Properties |
| Melting point | 178-182 °C | | Boiling point | 419.6±35.0 °C(Predicted) | | density | 1.688±0.06 g/cm3(Predicted) | | pka | pK1:1.62 (25°C) | | BRN | 1983247 | | InChI | 1S/C7H4N2O6/c10-7(11)5-3-4(8(12)13)1-2-6(5)9(14)15/h1-3H,(H,10,11) | | InChIKey | YKMDNKRCCODWMG-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(ccc1[N+]([O-])=O)[N+]([O-])=O | | CAS DataBase Reference | 610-28-6(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2,5-dinitro- (610-28-6) |
| WGK Germany | 3 | | RTECS | DG9140550 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 2,5-DINITROBENZOIC ACID Usage And Synthesis |
| Chemical Properties | Prismatic crystals. Melting point 177-178°C. Soluble in ethanol, ether and hot water. | | Uses | 2,5-Dinitrobenzoic acid is a benzoic acid derivative. Its proton, deuteron and proton spin-lattice relaxation times have been evaluated by using Schrödinger wave equation. | | General Description | 2,5-Dinitrobenzoic acid is a benzoic acid derivative. Its proton, deuteron and proton spin-lattice relaxation times have been evaluated by using Schr?dinger wave equation. | | Purification Methods | Crystallise the acid from distilled H2O. Dry it in a vacuum desiccator. [Beilstein 9 II 279, 9 III 1778, 9 IV 1241.] |
| | 2,5-DINITROBENZOIC ACID Preparation Products And Raw materials |
|