- Gibbs reagent
-
- $64.00 / 200mg
-
2026-04-21
- CAS:101-38-2
- Min. Order:
- Purity: 99.66%
- Supply Ability: 10g
|
| | 2,6-Dichloroquinone-4-chloroimide Basic information |
| Product Name: | 2,6-Dichloroquinone-4-chloroimide | | Synonyms: | LABOTEST-BB LT00159911;GIBB'S REAGENT;2,5-Cyclohexadien-1-one, 2,6-dichloro-4-(chloroimino)-;2,5-Cyclohexadien-1-one, 4-chloroimino-2,6-dichloro-;2,6-Dichloro-4-(chloroimino)-2,5-cyclohexadien-1-one;2,6-dichloro-4-(chloroimino)-5-cyclohexadien-1-one;2,6-Dichloro-4-N-chloroquinonimine;2,6-Dichlorobenzoquinone chloroimide | | CAS: | 101-38-2 | | MF: | C6H2Cl3NO | | MW: | 210.45 | | EINECS: | 202-937-2 | | Product Categories: | Anthraquinones, Hydroquinones and Quinones | | Mol File: | 101-38-2.mol |  |
| | 2,6-Dichloroquinone-4-chloroimide Chemical Properties |
| Melting point | 65-67 °C(lit.) | | Boiling point | 262.3±50.0 °C(Predicted) | | bulk density | 800kg/m3 | | density | 1.5917 (rough estimate) | | refractive index | 1.5470 (estimate) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Sparingly), DMSO (Slightly) | | pka | -4+-.0.20(Predicted) | | form | crystalline | | color | yellow | | Water Solubility | Insoluble | | Merck | 14,4421 | | Stability: | Stable. Keep refrigerated. | | InChI | 1S/C6H2Cl3NO/c7-4-1-3(10-9)2-5(8)6(4)11/h1-2H | | InChIKey | YHUMTHWQGWPJOQ-UHFFFAOYSA-N | | SMILES | Cl\N=C1\C=C(Cl)C(=O)C(Cl)=C1 | | CAS DataBase Reference | 101-38-2(CAS DataBase Reference) | | NIST Chemistry Reference | N,2,6-trichloro-p-quinoneimine(101-38-2) | | EPA Substance Registry System | 2,5-Cyclohexadien-1-one, 2,6-dichloro-4-(chloroimino)- (101-38-2) |
| Hazard Codes | F,Xi,Xn,E | | Risk Statements | 5-11-36/37/38-20/22-2 | | Safety Statements | 15-26-36/37/39-33-16-36 | | RIDADR | UN 3224 4.1 | | WGK Germany | 3 | | RTECS | GU5470000 | | F | 21 | | TSCA | TSCA listed | | HazardClass | 5.1 | | PackingGroup | III | | HS Code | 29251900 | | Storage Class | 4.1A - Other explosive hazardous materials | | Hazard Classifications | Eye Irrit. 2
Self-react. C
Skin Irrit. 2 |
| | 2,6-Dichloroquinone-4-chloroimide Usage And Synthesis |
| Chemical Properties | yellow crystals | | Uses | 2,6-Dichloroquinone-4-chloroimide, also known as Gibbs Reagent, is used as a reagent for the spectrophotometric determination of phenols as well as other aromatic compounds. | | Uses | In determination of phenols. |
| | 2,6-Dichloroquinone-4-chloroimide Preparation Products And Raw materials |
|