|
|
| | 2,4,6-TRIPHENYLPYRIDINE Basic information |
| Product Name: | 2,4,6-TRIPHENYLPYRIDINE | | Synonyms: | 2,4,6-Triphenyl-pyridin;TIMTEC-BB SBB007852;2,4,6-TRIPHENYLPYRIDINE;PYRIDINE,2,4,6-TRIPHENYL | | CAS: | 580-35-8 | | MF: | C23H17N | | MW: | 307.39 | | EINECS: | | | Product Categories: | | | Mol File: | 580-35-8.mol |  |
| | 2,4,6-TRIPHENYLPYRIDINE Chemical Properties |
| Melting point | 139.0 to 143.0 °C | | Boiling point | 220-230 °C(Press: 0.3 Torr) | | density | 1.103±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.95±0.10(Predicted) | | color | White to Almost white | | λmax | 312nm(EtOH)(lit.) | | InChI | InChI=1S/C23H17N/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20/h1-17H | | InChIKey | FRZHWQQBYDFNTH-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=NC(C2=CC=CC=C2)=CC(C2=CC=CC=C2)=C1 |
| | 2,4,6-TRIPHENYLPYRIDINE Usage And Synthesis |
| | 2,4,6-TRIPHENYLPYRIDINE Preparation Products And Raw materials |
|