- Cholesteryl benzoate
-
- $1.00 / 1KG
-
2020-01-09
- CAS:604-32-0
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons/month
|
| | Cholesteryl benzoate Basic information |
| | Cholesteryl benzoate Chemical Properties |
| Melting point | 148-150 °C (lit.) | | alpha | -15 º (c=2, CHCl3) | | Boiling point | 545.16°C (rough estimate) | | density | 0.9276 (rough estimate) | | refractive index | 1.4875 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | INSOLUBLE | | form | Crystalline Powder | | color | White | | Optical Rotation | [α]20/D 15.0°, c = 2 in chloroform | | Water Solubility | INSOLUBLE | | Merck | 14,2201 | | BRN | 3225829 | | InChIKey | UVZUFUGNHDDLRQ-LLHZKFLPSA-N | | SMILES | O=C(O[C@@H]1CC2=CC[C@]3([H])[C@@](CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCCC(C)C)([H])[C@@]2(C)CC1)C5=CC=CC=C5 | | LogP | 12.396 (est) | | CAS DataBase Reference | 604-32-0(CAS DataBase Reference) | | NIST Chemistry Reference | Cholesteryl benzoate(604-32-0) | | EPA Substance Registry System | Cholest-5-en-3-ol (3.beta.)-, benzoate (604-32-0) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29163100 | | Storage Class | 11 - Combustible Solids |
| | Cholesteryl benzoate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Pharmaceutic aid (emulsifying agent) | | Uses | Cholesteryl benzoate (CB) is a structure directing agent which can be used in the growth of oriented lithium iron phosphate (LiFePO4) for the fabrication of lithium ion batteries. It can be used in the fabrication of polymer dispersed liquid crystals (PDLC) which show liquid crystallinity by cooling the material from the isotropic phase. | | General Description | Cholesteryl benzoate (CB) is a cholesteryl ester which is used in cholesteric liquid crystals by forming layered spiral staircases in which the rotation angle is temperature dependent. |
| | Cholesteryl benzoate Preparation Products And Raw materials |
|