|
|
| | 6-AMINO-1,3-DIMETHYL-5-NITROSOURACIL Basic information |
| | 6-AMINO-1,3-DIMETHYL-5-NITROSOURACIL Chemical Properties |
| Melting point | 241-243°C | | Boiling point | 240.8±50.0℃ (760 Torr) | | density | 1.61±0.1 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.6500 (estimate) | | Fp | 99.5±30.1℃ | | storage temp. | −20°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 1.16±0.70(Predicted) | | color | Pink to Purple | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H8N4O3/c1-9-4(7)3(8-13)5(11)10(2)6(9)12/h7H2,1-2H3 | | InChIKey | MGBDANYXBKROBW-UHFFFAOYSA-N | | SMILES | C1(=O)N(C)C(N)=C(N=O)C(=O)N1C | | EPA Substance Registry System | 1,3-Dimethyl-6-amino-5-nitrosouracil (6632-68-4) |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | RTECS | YQ8780000 |
| | 6-AMINO-1,3-DIMETHYL-5-NITROSOURACIL Usage And Synthesis |
| Chemical Properties | Bright Pink Solid | | Uses | 4-Amino-1,3-dimethyl-5-nitrosouracil is a useful building block for organic synthesis. |
| | 6-AMINO-1,3-DIMETHYL-5-NITROSOURACIL Preparation Products And Raw materials |
|