- 2-Pentanethiol
-
- $0.00 / 25kg
-
2025-12-01
- CAS:2084-19-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- 2-Pentanethiol
-
- $2.20 / 1000kg
-
2025-10-13
- CAS:2084-19-7
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 1000kg
- 2-Pentanethiol
-
- $79.00/ kg
-
2025-05-23
- CAS:2084-19-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20ton
|
| | 2-Pentanethiol Basic information |
| Product Name: | 2-Pentanethiol | | Synonyms: | 1-Methylbutanethiol;1-Methylbutyl hydrosulfide;pentane-2-thiol;2-Pentanethiol(7CI,8CI,9CI);2-PENTANETHIOL;2-MERCAPTO PENTANE;SEC-AMYL MERCAPTAN;2-PENTANETHIOL 97+% | | CAS: | 2084-19-7 | | MF: | C5H12S | | MW: | 104.21 | | EINECS: | 218-224-4 | | Product Categories: | thiol Flavor | | Mol File: | 2084-19-7.mol |  |
| | 2-Pentanethiol Chemical Properties |
| Melting point | -168.95°C | | Boiling point | 101 °C(lit.) | | density | 0.827 g/mL at 25 °C(lit.) | | FEMA | 3792 | 2-PENTANETHIOL | | refractive index | n20/D 1.4410(lit.) | | Fp | 80 °F | | form | liquid | | pka | 10.96±0.10(Predicted) | | Odor | sulfury gassy | | Odor Type | sulfurous | | JECFA Number | 514 | | InChI | InChI=1S/C5H12S/c1-3-4-5(2)6/h5-6H,3-4H2,1-2H3 | | InChIKey | QUSTYFNPKBDELJ-UHFFFAOYSA-N | | SMILES | CC(S)CCC | | LogP | 2.66 | | CAS DataBase Reference | 2084-19-7(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Pentanethiol(2084-19-7) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.1 | | PackingGroup | II |
| | 2-Pentanethiol Usage And Synthesis |
| Chemical Properties | 2-Pentanethiol has an unpleasant odor and is sulfuraceous and gassy. | | Occurrence | Reported found in guava and yellow passion fruit. | | Definition | ChEBI: 2-Pentanethiol is an alkanethiol. | | Aroma threshold values | Aroma characteristics at 0.1%: sulfurous, ripe fruity, pineapple and tropical fruitlike with a sautéed and
roasted savory nuance. | | Taste threshold values | Taste characteristics at 0.1 ppm: sulfurous coffee and bacon with roasted savory and tropical pulpy pineapplelike
notes. |
| | 2-Pentanethiol Preparation Products And Raw materials |
|