|
|
| | 3,4-DIHYDRO-6-[(TERT-BUTYL)DIMETHYL SILYLOXY]-2H-PYRAN Basic information |
| Product Name: | 3,4-DIHYDRO-6-[(TERT-BUTYL)DIMETHYL SILYLOXY]-2H-PYRAN | | Synonyms: | 3,4-DIHYDRO-6-[(TERT-BUTYL)DIMETHYL SILYLOXY]-2H-PYRAN;6-(TERT-BUTYLDIMETHYLSILYLOXY)-3,4-DIHYDRO-2 H-PYRAN;6-(t-butyldimethylsiloxy)-3,4-dihydro-2h-pyran;6-(TERT-BUTYLDIMETHYLSILYLOXY)-3,4- DIHYDRO-2H-PYRANE;t-Butyl-Dimethyl-(3,4-Dihydro-2H-Pyran-6-Yloxy)Silane;tert-Butyl((3,4-dihydro-2H-pyran-6-yl)oxy)diMethylsilane;2H-Pyran, 6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-3,4-dihydro-;6-(tert-Butyldimethylsilyloxy)-3,4-dihydro-2H-pyran 95% | | CAS: | 130650-09-8 | | MF: | C11H22O2Si | | MW: | 214.38 | | EINECS: | | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Pyrans | | Mol File: | 130650-09-8.mol | ![3,4-DIHYDRO-6-[(TERT-BUTYL)DIMETHYL SILYLOXY]-2H-PYRAN Structure](CAS/GIF/130650-09-8.gif) |
| | 3,4-DIHYDRO-6-[(TERT-BUTYL)DIMETHYL SILYLOXY]-2H-PYRAN Chemical Properties |
| Boiling point | 125-131 °C/28 mmHg (lit.) | | density | 0.935 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.455(lit.) | | Fp | 177 °F | | storage temp. | 2-8°C | | Specific Gravity | 0.935 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C11H22O2Si/c1-11(2,3)14(4,5)13-10-8-6-7-9-12-10/h8H,6-7,9H2,1-5H3 | | InChIKey | RBKFRODDAPGVLP-UHFFFAOYSA-N | | SMILES | CC(C)(C)[Si](C)(C)OC1=CCCCO1 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 3,4-DIHYDRO-6-[(TERT-BUTYL)DIMETHYL SILYLOXY]-2H-PYRAN Usage And Synthesis |
| Uses | 6-(tert-Butyldimethylsilyloxy)-3,4-dihydro-2H-pyran, a heterocyclic building block, is a pyran derivative. Various physical properties of 6-(tert-butyldimethylsilyloxy)-3,4-dihydro-2H-pyran have been reported. | | General Description | 6-(tert-Butyldimethylsilyloxy)-3,4-dihydro-2H-pyran, a heterocyclic building block, is a pyran derivative. Various physical properties of 6-(tert-butyldimethylsilyloxy)-3,4-dihydro-2H-pyran have been reported. |
| | 3,4-DIHYDRO-6-[(TERT-BUTYL)DIMETHYL SILYLOXY]-2H-PYRAN Preparation Products And Raw materials |
|