|
|
| | 2-(3-Benzoylphenyl)propionitrile Basic information |
| | 2-(3-Benzoylphenyl)propionitrile Chemical Properties |
| Melting point | 47-53 °C(lit.) | | Boiling point | 400.8±28.0 °C(Predicted) | | density | 1.115±0.06 g/cm3(Predicted) | | vapor pressure | 10Pa at 20-50℃ | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | Major Application | pharmaceutical (small molecule) pharmaceutical | | InChI | InChI=1S/C16H13NO/c1-12(11-17)14-8-5-9-15(10-14)16(18)13-6-3-2-4-7-13/h2-10,12H,1H3 | | InChIKey | RGYOCHMZSLUCNP-UHFFFAOYSA-N | | SMILES | C1(=CC=CC(C(C)C#N)=C1)C(=O)C1C=CC=CC=1 | | CAS DataBase Reference | 42872-30-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | CY1693000 | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids |
| | 2-(3-Benzoylphenyl)propionitrile Usage And Synthesis |
| Uses | 2-(3-Benzoylphenyl)propionitrile was used as a substrate to study the enantioselectivity of nitrile hydratase from Rhodococcus equi A4. |
| | 2-(3-Benzoylphenyl)propionitrile Preparation Products And Raw materials |
|