|
|
| | 2-METHOXY-4-NITROBENZALDEHYDE Basic information |
| | 2-METHOXY-4-NITROBENZALDEHYDE Chemical Properties |
| Melting point | 120-124 °C | | Boiling point | 354.7±27.0 °C(Predicted) | | density | 1.322±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | color | White to Yellow to Green | | InChI | 1S/C8H7NO4/c1-13-8-4-7(9(11)12)3-2-6(8)5-10/h2-5H,1H3 | | InChIKey | LEBUUZXTHMCZQZ-UHFFFAOYSA-N | | SMILES | COc1cc(ccc1C=O)[N+]([O-])=O | | CAS DataBase Reference | 136507-15-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2913000090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 2-METHOXY-4-NITROBENZALDEHYDE Usage And Synthesis |
| Uses | 2-Methoxy-4-nitrobenzaldehyde is used in perparation of N-((oxazolyl)phenyl)chromanecarboxamide derivatives as therapeutically active substances for the treatment of retinal diseases. |
| | 2-METHOXY-4-NITROBENZALDEHYDE Preparation Products And Raw materials |
|