5-(TRIFLUOROMETHOXY)ISATIN manufacturers
|
| | 5-(TRIFLUOROMETHOXY)ISATIN Basic information |
| Product Name: | 5-(TRIFLUOROMETHOXY)ISATIN | | Synonyms: | 5-(Trifluoromethoxy)isatin 97%;5-(trifluoroMethoxy)-2,3-dihydro-1H-indole-2,3-dione;5-(Trifluoromethoxy)indole-2,3-dione;5-(Trifluoromethoxy)-1H-indole-2,3-dione, 5-(Trifluoromethoxy)indoline-2,3-dione, 2,3-Dihydro-2,3-dioxo-5-(trifluoromethoxy)-1H-indole;5-(TRIFLUOROMETHOXY)ISATIN;5-(TRIFLUOROMETHOXYL)INDOLINE-2,3-DIONE;BUTTPARK 34\07-90;5-(Trifluoromethoxy)indoline-2,3-dione | | CAS: | 169037-23-4 | | MF: | C9H4F3NO3 | | MW: | 231.13 | | EINECS: | 1592732-453-0 | | Product Categories: | Fused Ring Systems;Building Blocks;Heterocyclic Building Blocks;Indoles;blocks;IndolesOxindoles;Indane/Indanone and Derivatives | | Mol File: | 169037-23-4.mol |  |
| | 5-(TRIFLUOROMETHOXY)ISATIN Chemical Properties |
| Melting point | 170-172 °C(lit.) | | density | 1.562±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 8.49±0.20(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | Water Solubility | Insoluble in water. | | InChI | 1S/C9H4F3NO3/c10-9(11,12)16-4-1-2-6-5(3-4)7(14)8(15)13-6/h1-3H,(H,13,14,15) | | InChIKey | XHAJMVPMNOBILF-UHFFFAOYSA-N | | SMILES | FC(F)(F)Oc1ccc2NC(=O)C(=O)c2c1 | | CAS DataBase Reference | 169037-23-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HS Code | 29339900 | | Storage Class | 13 - Non Combustible Solids |
| | 5-(TRIFLUOROMETHOXY)ISATIN Usage And Synthesis |
| Uses | 5-(Trifluoromethoxy)isatin is used as a reactant for preparation of oxindole derivatives as TAk1 kinase inhibitors and of isatin thiosemicarbazones via condensation with thiosemicarbazones as herpes simplex virus (HSV) inhibitors. It is also used as a reactant for synthesis of 3-substituted 2-indolinone RET kinase inhibitors and for preparation of indolone acetamides as antiseizure agents. |
| | 5-(TRIFLUOROMETHOXY)ISATIN Preparation Products And Raw materials |
|