|
|
| | Cobalt bis(2-ethylhexanoate) Basic information |
| | Cobalt bis(2-ethylhexanoate) Chemical Properties |
| density | 1.002 g/mL at 25 °C | | vapor pressure | 5Pa at 25℃ | | Fp | 104 °F | | form | liquid | | color | purple | | Water Solubility | 40.3g/L at 20℃ | | InChI | InChI=1S/2C8H16O2.Co/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 | | InChIKey | QAEKNCDIHIGLFI-UHFFFAOYSA-L | | SMILES | [Co+2].C([O-])(=O)C(CC)CCCC.C([O-])(=O)C(CC)CCCC | | CAS DataBase Reference | 136-52-7(CAS DataBase Reference) | | EPA Substance Registry System | Hexanoic acid, 2-ethyl-, cobalt(2+) salt (136-52-7) |
| | Cobalt bis(2-ethylhexanoate) Usage And Synthesis |
| Uses | Paint driers, Polyester initiators, Petrochemical catalysts | | Uses | Polymerization accelerator | | Flammability and Explosibility | Not classified | | reaction suitability | core: cobalt | | Toxics Screening Level | The initial threshold screening level (ITSL) for cobalt-2-ethylhexanoate (CAS# 136-52-7) is 0.2 μg/m3 based on an 8-hour averaging time. |
| | Cobalt bis(2-ethylhexanoate) Preparation Products And Raw materials |
|