|
|
| | Boc-O-(2-bromo-Cbz)-L-Tyrosine Basic information |
| | Boc-O-(2-bromo-Cbz)-L-Tyrosine Chemical Properties |
| Melting point | 112-115 °C | | alpha | 8 º (c=1% in methanol) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | Major Application | peptide synthesis | | InChI | 1S/C22H24BrNO7/c1-22(2,3)31-20(27)24-18(19(25)26)12-14-8-10-16(11-9-14)30-21(28)29-13-15-6-4-5-7-17(15)23/h4-11,18H,12-13H2,1-3H3,(H,24,27)(H,25,26)/t18-/m1/s1 | | InChIKey | UYWMYJQSTUVRHR-GOSISDBHSA-N | | SMILES | Brc1c(cccc1)COC(=O)Oc2ccc(cc2)C[C@@H](NC(=O)OC(C)(C)C)C(=O)O | | CAS DataBase Reference | 47689-67-8(CAS DataBase Reference) | | EPA Substance Registry System | N-tert-Butoxycarbonyl-L-tyrosine 2-bromobenzylcarbonate (ester) (47689-67-8) |
| WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids |
| | Boc-O-(2-bromo-Cbz)-L-Tyrosine Usage And Synthesis |
| Uses | Boc-O-(2-bromo-Z)-L-Tyrosine, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-O-(2-bromo-Cbz)-L-Tyrosine Preparation Products And Raw materials |
|