| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
ChemCollect GmbH |
| Tel: |
+49 (0) 202 4690049 |
| Email: |
contact@chemcollect.de |
|
| | 2-(3-Chloro-phenyl)-thiazolidine-4-carboxylic acid Basic information |
| | 2-(3-Chloro-phenyl)-thiazolidine-4-carboxylic acid Chemical Properties |
| form | solid | | InChI | 1S/C10H10ClNO2S/c11-7-3-1-2-6(4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14) | | InChIKey | ZIAXCRNTOFXJPM-UHFFFAOYSA-N | | SMILES | O=C(O)C1NC(C2=CC=CC(Cl)=C2)SC1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(3-Chloro-phenyl)-thiazolidine-4-carboxylic acid Usage And Synthesis |
| | 2-(3-Chloro-phenyl)-thiazolidine-4-carboxylic acid Preparation Products And Raw materials |
|