|
|
| | 9-Ethyl-3-nitrocarbazole Basic information |
| | 9-Ethyl-3-nitrocarbazole Chemical Properties |
| Melting point | 128-130 °C (lit.) | | Boiling point | 362.3±24.0 °C(Predicted) | | density | 1.35 g/cm3 | | InChI | InChI=1S/C14H12N2O2/c1-2-15-13-6-4-3-5-11(13)12-9-10(16(17)18)7-8-14(12)15/h3-9H,2H2,1H3 | | InChIKey | WONHLSYSHMRRGO-UHFFFAOYSA-N | | SMILES | N1(CC)C2=C(C=CC=C2)C2=C1C=CC([N+]([O-])=O)=C2 | | CAS DataBase Reference | 86-20-4(CAS DataBase Reference) | | EPA Substance Registry System | 9H-Carbazole, 9-ethyl-3-nitro- (86-20-4) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 9-Ethyl-3-nitrocarbazole Usage And Synthesis |
| Uses | 9-Ethyl-3-nitrocarbazole can be prepared from 9-ethyl carbazole via nitration. Its crystals exhibit triclinic crystal system. | | General Description | 9-Ethyl-3-nitrocarbazole can be prepared from 9-ethyl carbazole via nitration. Its crystals exhibit triclinic crystal system. |
| | 9-Ethyl-3-nitrocarbazole Preparation Products And Raw materials |
|