|
|
| | L-ASPARTIC ACID POTASSIUM SALT Basic information |
| Product Name: | L-ASPARTIC ACID POTASSIUM SALT | | Synonyms: | l-asparticacid,monopotassiumsalthydrate;Potassium L-Aspartate Hydrate;L-aspartic acid potasium salt;L-Aspartic acid K salt;L-aspartic acid Potassium;Butanedioate, 2-amino-, potassium salt (1:1);L-ASPARTIC ACID POTASSIUM SALT, >=98;L-ASPARTIC ACID POTASSIUM SALT, PURI | | CAS: | 1115-63-5 | | MF: | C4H8KNO4 | | MW: | 173.21 | | EINECS: | 214-226-4 | | Product Categories: | | | Mol File: | 1115-63-5.mol |  |
| | L-ASPARTIC ACID POTASSIUM SALT Chemical Properties |
| refractive index | 20.5 ° (C=8, 6mol/L HCl) | | storage temp. | Store desiccated in air-tight containers. | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 13.5±1°, c = 1% in H2O | | Merck | 14,840 | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | 1S/C4H7NO4.K/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/q;+1/p-1/t2-;/m0./s1 | | InChIKey | TXXVQZSTAVIHFD-DKWTVANSSA-M | | SMILES | N[C@H](C([O-])=O)CC(O)=O.[K+] | | LogP | -0.669 (est) | | EPA Substance Registry System | L-Aspartic acid, monopotassium salt (1115-63-5) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | CI9458500 | | TSCA | TSCA listed | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | L-ASPARTIC ACID POTASSIUM SALT Usage And Synthesis |
| Chemical Properties | White cryst. powder | | Uses | L-Aspartic acid potassium salt has been used:
- to prepare perforated patch-clamp intracellular solution
- in serum glutamate–oxaloacetate transaminase (SGOT) assay
- as a component in an internal solution (IS) for mitoflash assay to detect mitochondrial flashes in permeabilized cells
| | General Description | L-aspartic acid is a non-essential amino acid. | | Biochem/physiol Actions | L-Aspartic acid is an endogenous N-methyl-D-aspartate (NMDA) receptor agonist. | | IC 50 | Microbial Metabolite; Human Endogenous Metabolite |
| | L-ASPARTIC ACID POTASSIUM SALT Preparation Products And Raw materials |
|