|
|
| | 4-Oxazolecarboxylic acid, 2,2′-cyclopropylidenebis[4,5-dihydro-, 4,4′-bis(1,1-dimethylethyl) ester, (4S,4′S)- Basic information |
| Product Name: | 4-Oxazolecarboxylic acid, 2,2′-cyclopropylidenebis[4,5-dihydro-, 4,4′-bis(1,1-dimethylethyl) ester, (4S,4′S)- | | Synonyms: | (4S,4'S)-Di-tert-butyl 2,2'-(cyclopropane-1,1-diyl)bis(4,5-dihydrooxazole-4-carboxylate);di-tert-Butyl 2,2'-(Cyclopropane-1,1-diyl)(4S,4'S)-bis(4,5-dihydrooxazole-4-carboxylate);sBOX(tBu);di-tert-Butyl 2,2'-(Cyclopropane-1,1-diyl)(4S,4'S)-bis(4,5-dihydrooxazole-4-carboxylate);4-Oxazolecarboxylic acid, 2,2′-cyclopropylidenebis[4,5-dihydro-, 4,4′-bis(1,1-dimethylethyl) ester, (4S,4′S)- | | CAS: | 2328084-27-9 | | MF: | C19H28N2O6 | | MW: | 380.44 | | EINECS: | | | Product Categories: | | | Mol File: | 2328084-27-9.mol |  |
| | 4-Oxazolecarboxylic acid, 2,2′-cyclopropylidenebis[4,5-dihydro-, 4,4′-bis(1,1-dimethylethyl) ester, (4S,4′S)- Chemical Properties |
| Melting point | 120.5°C | | Boiling point | 449.1±45.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.87±0.70(Predicted) | | form | powder or solid | | Appearance | White to yellow Solid | | InChI | 1S/C19H28N2O6/c1-17(2,3)26-13(22)11-9-24-15(20-11)19(7-8-19)16-21-12(10-25-16)14(23)27-18(4,5)6/h11-12H,7-10H2,1-6H3/t11-,12-/m0/s1 | | InChIKey | LKXTWWHADOFMCC-RYUDHWBXSA-N | | SMILES | N1=C(OC[C@H]1C(=O)OC(C)(C)C)C3(CC3)C2=N[C@@H](CO2)C(=O)OC(C)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-Oxazolecarboxylic acid, 2,2′-cyclopropylidenebis[4,5-dihydro-, 4,4′-bis(1,1-dimethylethyl) ester, (4S,4′S)- Usage And Synthesis |
| Uses | sBOX(tBu) is a serine-derived chiral bisoxazoline ligand. The additional coordinating functionality provided by the esters enables new reactivity compared to traditional BOX ligands. sBOX(iPr) has been shown to be an optimal ligand for the electrocatalytic cyanophosphorylation as well as hydrocyanation of vinylarenes. Product can be used with our Synlectro electrochemistry platform (ESYNTH001) |
| | 4-Oxazolecarboxylic acid, 2,2′-cyclopropylidenebis[4,5-dihydro-, 4,4′-bis(1,1-dimethylethyl) ester, (4S,4′S)- Preparation Products And Raw materials |
|