| Company Name: |
Sci General Material & Chemical Ltd
|
| Tel: |
021-58388037;21-58388037 13472507714 |
| Email: |
35177634@qq.com;1589045147@qq.com |
| Products Intro: |
Product Name:1-(3-CHLORO-4-FLUORO-5-(TRIFLUOROMETHYL)PHENYL)-2,2,2-TRI CAS:2138407-75-5 Purity:99% Package:1kg;25kg
|
| Company Name: |
Anstar Chemical (Group) Co.,Ltd.
|
| Tel: |
18053179586 |
| Email: |
export@anstarchemical.com |
| Products Intro: |
Product Name:1-(3-Chloro-4-fluoro-5-(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone CAS:2138407-75-5 Purity:99% Package:25KG/桶
|
|
| | Ethanone, 1-[3-chloro-4-fluoro-5-(trifluoromethyl)phenyl]-2,2,2-trifluoro- Basic information |
| | Ethanone, 1-[3-chloro-4-fluoro-5-(trifluoromethyl)phenyl]-2,2,2-trifluoro- Chemical Properties |
| Boiling point | 221.3±40.0 °C(Predicted) | | density | 1.574±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C9H2ClF7O/c10-5-2-3(7(18)9(15,16)17)1-4(6(5)11)8(12,13)14/h1-2H | | InChIKey | NFRSYFDRKBKVET-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(C(F)(F)F)=C(F)C(Cl)=C1)C(F)(F)F |
| | Ethanone, 1-[3-chloro-4-fluoro-5-(trifluoromethyl)phenyl]-2,2,2-trifluoro- Usage And Synthesis |
| | Ethanone, 1-[3-chloro-4-fluoro-5-(trifluoromethyl)phenyl]-2,2,2-trifluoro- Preparation Products And Raw materials |
|