| Company Name: |
Shanghai Haohong Scientific Co., Ltd. Gold
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:tert-Butyl (3-bromocyclobutyl)carbamate
CAS:1936399-47-1
Purity:97%
|
| Company Name: |
Carbott PharmTech Inc.
|
| Tel: |
0535-6385396 |
| Email: |
info@carbottpharm.com |
| Products Intro: |
Product Name:tert-Butyl (3-bromocyclobutyl)carbamate
CAS:1936399-47-1
Purity:97% Package:10g；100g；1kg
|
|
| | Carbamic acid, N-(3-bromocyclobutyl)-, 1,1-dimethylethyl ester Basic information |
| | Carbamic acid, N-(3-bromocyclobutyl)-, 1,1-dimethylethyl ester Chemical Properties |
| Boiling point | 305.7±31.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 11.78±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H16BrNO2/c1-9(2,3)13-8(12)11-7-4-6(10)5-7/h6-7H,4-5H2,1-3H3,(H,11,12) | | InChIKey | PZFNRPBCGYMXDZ-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1CC(Br)C1 |
| | Carbamic acid, N-(3-bromocyclobutyl)-, 1,1-dimethylethyl ester Usage And Synthesis |
| | Carbamic acid, N-(3-bromocyclobutyl)-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|