1H-Pyrazole, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- manufacturers
|
| | 1H-Pyrazole, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- Basic information |
| Product Name: | 1H-Pyrazole, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | | Synonyms: | 1H-Pyrazole, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;3-Fluoropyrazole-4-boronic Acid Pinacol Ester;3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole - [F84441];3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole | | CAS: | 1983153-03-2 | | MF: | C9H14BFN2O2 | | MW: | 212.03 | | EINECS: | | | Product Categories: | | | Mol File: | 1983153-03-2.mol |  |
| | 1H-Pyrazole, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- Chemical Properties |
| Boiling point | 336.8±27.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. -20°C | | pka | 10+-.0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H14BFN2O2/c1-8(2)9(3,4)15-10(14-8)6-5-12-13-7(6)11/h5H,1-4H3,(H,12,13) | | InChIKey | FUFLRCCNGTZOCT-UHFFFAOYSA-N | | SMILES | N1C=C(B2OC(C)(C)C(C)(C)O2)C(F)=N1 |
| | 1H-Pyrazole, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- Usage And Synthesis |
| | 1H-Pyrazole, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- Preparation Products And Raw materials |
|