| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
beta-Glc-PEG3-Azide >=95% manufacturers
- N3-PEG3-beta-D-glucose
-
-
2026-07-24
- CAS:156058-83-2
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
|
| | beta-Glc-PEG3-Azide >=95% Basic information |
| Product Name: | beta-Glc-PEG3-Azide >=95% | | Synonyms: | beta-Glc-PEG3-Azide >=95%;β-Glc-PEG3-Azide;N3-PEG3-beta-D-glucose;1-O-(2-(2-(2-Azidoethoxy)ethoxy)ethoxy)-beta-D-glucopyranoside;Azido-PEG3-beta-D-glucose | | CAS: | 156058-83-2 | | MF: | C12H23N3O8 | | MW: | 337.33 | | EINECS: | | | Product Categories: | | | Mol File: | 156058-83-2.mol |  |
| | beta-Glc-PEG3-Azide >=95% Chemical Properties |
| storage temp. | -20°C | | form | liquid | | biological source | synthetic (organic) | | InChI | 1S/C12H23N3O8/c13-15-14-1-2-20-3-4-21-5-6-22-12-11(19)10(18)9(17)8(7-16)23-12/h8-12,16-19H,1-7H2/t8,9-,10-,11,12+/m0/s1 | | InChIKey | ABBZTEUICIJBPU-MUVKAJBYSA-N | | SMILES | OCC1O[C@@H](OCCOCCOCCN=[N+]=[N-])[C@H](O)[C@@H](O)[C@H]1O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | beta-Glc-PEG3-Azide >=95% Usage And Synthesis |
| Biological Activity | β-Glc-PEG3-Azide is a PEGylated glycoside. PEGylated glycosides are used as ligands for Click Chemistry. They may also be important as carbohydrate carriers in glycotherapeutic applications, drug carriers for site-specific delivery, drug enhancers for decreasing toxicity, and solubility and protein enhancers. |
| | beta-Glc-PEG3-Azide >=95% Preparation Products And Raw materials |
|