|
|
| | 2-Pyridinecarboxamide, N-(2,6-dimethylphenyl)-1,6-dihydro-6-oxo- Basic information |
| Product Name: | 2-Pyridinecarboxamide, N-(2,6-dimethylphenyl)-1,6-dihydro-6-oxo- | | Synonyms: | 2-Pyridinecarboxamide, N-(2,6-dimethylphenyl)-1,6-dihydro-6-oxo-;N-(2,6-dimethylphenyl)-6-oxo-1H-pyridine-2-carboxamide;N-(2,6-Dimethylphenyl)-6-oxo-1,6-dihydropyridine-2-carboxamide;N-(2,6-Dimethylphenyl)-6-hydroxypyridine-2-carboxamide;N-(2,6-dimethylphenyl)-6-oxy-1,6-dihydropyridine-2-carboxamide;N-(2,6-dimethylphenyl)-6-hydroxypicolinamide | | CAS: | 1982260-18-3 | | MF: | C14H14N2O2 | | MW: | 242.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1982260-18-3.mol |  |
| | 2-Pyridinecarboxamide, N-(2,6-dimethylphenyl)-1,6-dihydro-6-oxo- Chemical Properties |
| Boiling point | 520.5±50.0 °C(Predicted) | | density | 1.244±0.06 g/cm3(Predicted) | | pka | 9.12±0.10(Predicted) | | form | powder | | color | white to off-white | | InChI | InChI=1S/C14H14N2O2/c1-9-5-3-6-10(2)13(9)16-14(18)11-7-4-8-12(17)15-11/h3-8H,1-2H3,(H,15,17)(H,16,18) | | InChIKey | RLTMFMKUMLGROY-UHFFFAOYSA-N | | SMILES | O=C1C=CC=C(N1)C(=O)NC=2C(=CC=CC2C)C |
| | 2-Pyridinecarboxamide, N-(2,6-dimethylphenyl)-1,6-dihydro-6-oxo- Usage And Synthesis |
| Uses | The ligand has been used in:
- The Cu-catalyzed sulfonamidation of (hetero)aryl halides
- The Cu-catalyzed cross coupling of primary amines and (hetero)aryl bromides
- Cu-catalyzed hydroxylation reactions of (hetero)aryl halides in water
- The synthesis of biaryl amines via the coupling of anilines and (hetero)aryl halides
|
| | 2-Pyridinecarboxamide, N-(2,6-dimethylphenyl)-1,6-dihydro-6-oxo- Preparation Products And Raw materials |
|