| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 6'',6''-Dimethylpyrano[2'',3'':7,8]flavone >=95% (LC/MS-UV) Basic information |
| Product Name: | 6'',6''-Dimethylpyrano[2'',3'':7,8]flavone >=95% (LC/MS-UV) | | Synonyms: | 6'',6''-Dimethylpyrano[2'',3'':7,8]flavone >=95% (LC/MS-UV);4H,8H-Benzo[1,2-b:3,4-b']dipyran-4-one, 8,8-dimethyl-2-phenyl-;6′′,6′′-Dimethylpyrano[2′′,3′′:7,8]flavone | | CAS: | 64125-32-2 | | MF: | C20H16O3 | | MW: | 304.34 | | EINECS: | | | Product Categories: | | | Mol File: | 64125-32-2.mol | ![6'',6''-Dimethylpyrano[2'',3'':7,8]flavone >=95% (LC/MS-UV) Structure](CAS/20210305/GIF/64125-32-2.gif) |
| | 6'',6''-Dimethylpyrano[2'',3'':7,8]flavone >=95% (LC/MS-UV) Chemical Properties |
| Melting point | 135-137 °C | | Boiling point | 479.8±45.0 °C(Predicted) | | density | 1.222±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: 1mg/mL | | form | solid | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChI | 1S/C20H16O3/c1-20(2)11-10-15-17(23-20)9-8-14-16(21)12-18(22-19(14)15)13-6-4-3-5-7-13/h3-12H,1-2H3 | | InChIKey | RBKWJAHRWPDNPM-UHFFFAOYSA-N | | SMILES | CC1(C)C=CC2=C(C=CC3=C2OC(C4=CC=CC=C4)=CC3=O)O1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 6'',6''-Dimethylpyrano[2'',3'':7,8]flavone >=95% (LC/MS-UV) Usage And Synthesis |
| Uses | metabolomics vitamins, nutraceuticals, and natural products | | Definition | ChEBI: 8,8-dimethyl-2-phenyl-4H,8H-pyrano[2,3-h]chromen-4-one is an extended flavonoid. |
| | 6'',6''-Dimethylpyrano[2'',3'':7,8]flavone >=95% (LC/MS-UV) Preparation Products And Raw materials |
|