|
|
| | (2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide) Basic information |
| | (2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide) Chemical Properties |
| Melting point | 129-130°C | | Boiling point | 392°C | | density | 1.087 | | Fp | 149°C | | storage temp. | Refrigerator | | solubility | DMSO, Methanol (Slightly), Water (Slightly, Heated and Sonicated) | | pka | 14.85±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | Consistent with structure | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C14H20N2O/c1-10-6-5-7-11(2)13(10)16-14(17)12-8-3-4-9-15-12/h5-7,12,15H,3-4,8-9H2,1-2H3,(H,16,17)/t12-/m0/s1 | | InChIKey | SILRCGDPZGQJOQ-LBPRGKRZSA-N | | SMILES | N1CCCC[C@H]1C(NC1=C(C)C=CC=C1C)=O | | CAS DataBase Reference | 27262-40-4(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2933.39.9200 | | Storage Class | 11 - Combustible Solids |
| | (2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide) Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | anti-hypertensive | | Uses | N-Despropyl Ropivacaine (Ropivacaine EP Impurity B) is a major metabolite of Levobupivacaine (B689546) and the anesthetic Ropivacaine (R675000). | | Definition | ChEBI: (S)-2',6'-Pipecoloxylidide is an amino acid amide. |
| | (2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide) Preparation Products And Raw materials |
|