| Company Name: |
ACE BIOSCIENCES
|
| Tel: |
+91-9395105396 |
| Email: |
kalisha@acebiosciences.in |
| Products Intro: |
Product Name:PBDE 99 (2,2',4,4',5-Pentabromodiphenyl ether)
CAS:60348-60-9
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| | 2,2',4,4',5-PENTABROMODIPHENYL ETHER Basic information |
| Product Name: | 2,2',4,4',5-PENTABROMODIPHENYL ETHER | | Synonyms: | 2,2',4,4',5-PENTABROMODIPHENYL ETHER;PBDE-99;22445PENTABROMINATEDDIPHENYLETHER;BDE-99;2,2μ,4,4μ,5-PentaBDE, 2,2μ,4,4μ,5-Pentabromodiphenyl ether solution, PBDE 99;BDE No 99 solution;2,24,4’,5-Pentabromodiphenyl ether,50 μL/mL in Isooctane;1,2,4-Tribromo-5-(2,4-dibromophenoxy)benzene | | CAS: | 60348-60-9 | | MF: | C12H5Br5O | | MW: | 564.69 | | EINECS: | 208-759-1 | | Product Categories: | | | Mol File: | 60348-60-9.mol |  |
| | 2,2',4,4',5-PENTABROMODIPHENYL ETHER Chemical Properties |
| Melting point | 84-85 °C(Solv: tetrahydrofuran (109-99-9); water (7732-18-5); acetonitrile (75-05-8)) | | Boiling point | 416 °C | | density | 2.343±0.06 g/cm3(Predicted) | | Fp | -12 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly, Heated) | | form | Semi-Solid to Solid | | color | White to Pale Pink | | Henry's Law Constant | 1.5×100 mol/(m3Pa) at 25℃, Long et al. (2017) | | Stability: | Light Sensitive | | Major Application | environmental | | InChI | 1S/C12H5Br5O/c13-6-1-2-11(9(16)3-6)18-12-5-8(15)7(14)4-10(12)17/h1-5H | | InChIKey | WHPVYXDFIXRKLN-UHFFFAOYSA-N | | SMILES | BrC1=C(OC2=CC(Br)=C(Br)C=C2Br)C=CC(Br)=C1 | | EPA Substance Registry System | Benzene, 1,2,4-tribromo-5-(2,4-dibromophenoxy)- (60348-60-9) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 60-61-62-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Asp. Tox. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2',4,4',5-PENTABROMODIPHENYL ETHER Usage And Synthesis |
| Uses | 2,2',4,4',5-Pentabromodiphenyl ether is part of a group of polybromatinated diphenyl ethers that are widely used as brominated flame retardants. 2,2',4,4',5-Pentabromodiphenyl ether is suspected to be a toxic substance to humans, causing endocrine mediated effects on the body and possibly causing developmental effects in nursed babies. One of the new POPs under the Stockholm Convention | | Definition | ChEBI: 2,4-dibromophenyl 2,4,5-tribromophenyl ether is a polybromodiphenyl ether that is diphenyl ether in which the hydrogens at the 2, 4, 5, 2', and 4' positions have been replaced by bromines. |
| | 2,2',4,4',5-PENTABROMODIPHENYL ETHER Preparation Products And Raw materials |
|