|
|
| | Diethyl cromoglycate Basic information |
| Product Name: | Diethyl cromoglycate | | Synonyms: | Cromolyn Sodium USP Related Compound B;Diethyl chromoglycate;1,3-BIS(2-ETHOXYCARBONYLCHROMON-5-YLOXY)-2-HYDROXYPROPAN: DIETHYL CROMOGLYCATE;Diethyl cromoglicate;5-[3-(2-carbethoxy-4-keto-chromen-5-yl)oxy-2-hydroxy-propoxy]-4-keto-chromene-2-carboxylic acid ethyl ester;ethyl 5-[3-(2-ethoxycarbonyl-4-oxo-chromen-5-yl)oxy-2-hydroxy-propoxy]-4-oxo-chromene-2-carboxylate;ethyl 5-[3-(2-ethoxycarbonyl-4-oxochromen-5-yl)oxy-2-hydroxypropoxy]-4-oxochromene-2-carboxylate;2-[bromo(ethyl)amino]acetic acid ethyl ester | | CAS: | 16150-45-1 | | MF: | C27H24O11 | | MW: | 524.47 | | EINECS: | | | Product Categories: | Pharmaceutical Intermediates | | Mol File: | 16150-45-1.mol |  |
| | Diethyl cromoglycate Chemical Properties |
| Melting point | 180-182 °C(Solv: ethanol (64-17-5); benzene (71-43-2)) | | Boiling point | 715.2±60.0 °C(Predicted) | | density | 1.408±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly, Heated), DMSO (Slightly, Heated), Methanol (Slightly, Heat | | form | Solid | | pka | 13.02±0.20(Predicted) | | color | Pale Yellow to Pale Beige | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChIKey | KRBBSLDXYDBFEC-UHFFFAOYSA-N | | SMILES | C12C=CC=C(OCC(O)COC3=CC=CC4OC(C(=O)OCC)=CC(=O)C3=4)C=1C(=O)C=C(C(=O)OCC)O2 |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | Diethyl cromoglycate Usage And Synthesis |
| Uses | Diethyl cromoglycate is a derivative of Sodium cromoglycate (C815000). Sodium cromoglycate is a bischromone derivative that is used as prophylactic treatment and maintenance of bronchial asthma by preventing the release of histamine in the body. |
| | Diethyl cromoglycate Preparation Products And Raw materials |
|