|
|
| | 3-(4-Bromophenyl)propionic acid Basic information | | Application |
| | 3-(4-Bromophenyl)propionic acid Chemical Properties |
| Melting point | 133-136 °C (lit.) | | Boiling point | 250°C/30mmHg(lit.) | | density | 1.531±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 4.60±0.10(Predicted) | | form | Crystalline Powder | | color | White to light yellow or beige | | InChI | InChI=1S/C9H9BrO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6H2,(H,11,12) | | InChIKey | NCSTWHYWOVZDOC-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=C(Br)C=C1 | | CAS DataBase Reference | 1643-30-7(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3261 | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-(4-Bromophenyl)propionic acid Usage And Synthesis |
| Application | 3-(4-bromophenyl)propionic acid can be used as an organic synthesis intermediate and a pharmaceutical intermediate, and is mainly used in laboratory research and development processes and chemical and pharmaceutical synthesis processes. | | Chemical Properties | White to light yellow or beige crystalline powder |
| | 3-(4-Bromophenyl)propionic acid Preparation Products And Raw materials |
|