| Company Name: |
Capot Chemical Co.,Ltd. |
| Tel: |
+86-（0）57185586718; +8613336195806 |
| Email: |
sales@capot.com |
| Products Intro: |
Product Name:3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)toluene
CAS:253342-48-2
Purity:98%(Min,HPLC) Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
|
| | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)toluene Basic information |
| Product Name: | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)toluene | | Synonyms: | 3-Methylbenzeneboronic acid, pinacol ester 98%;m-Tolylboronic Acid Pinacol Ester;2-(3-TOLYL)-4,4,6-TRIMETHYL-1,3,2-DIOXABORINATE;3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)TOLUENE;3-TOLYLBORONIC ACID, HEXYLENE GLYCOL CYCLIC ESTER;3-METHYLPHENYLBORONIC ACID, PINACOL ESTER;4,4,5,5-Tetramethyl-2-(m-tolyl)-1,3,2-dioxaborolane;2-dioxaborolan-2-yl)toluene | | CAS: | 253342-48-2 | | MF: | C13H19BO2 | | MW: | 218.1 | | EINECS: | | | Product Categories: | | | Mol File: | 253342-48-2.mol |  |
| | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)toluene Chemical Properties |
| Melting point | 34.0 to 38.0 °C | | Boiling point | 307.2±21.0 °C(Predicted) | | density | 0.98±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to lump | | color | White to Almost white | | λmax | 273nm(CH3CN)(lit.) | | InChI | 1S/C13H19BO2/c1-10-7-6-8-11(9-10)14-15-12(2,3)13(4,5)16-14/h6-9H,1-5H3 | | InChIKey | XDKYCZBGHPGKEP-UHFFFAOYSA-N | | SMILES | CC1(C)C(C)(C)OB(C2=CC=CC(C)=C2)O1 | | CAS DataBase Reference | 253342-48-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)toluene Usage And Synthesis |
| | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)toluene Preparation Products And Raw materials |
| Raw materials | 2-(3-chloro-5-Methylphenyl)-4,4,5,5-tetraMethyl-
1,3,2-dioxaborolane-->M-TOLYLMAGNESIUM BROMIDE-->3-Iodotoluene-->m-Toluidine-->3-Chlorotoluene-->3-Bromotoluene-->Pinacolborane | | Preparation Products | Benzenamine, 3-methyl-N-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)--->4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)TOLUENE-->Pinacol |
|