|
|
| | 1,1-Cyclohexanediacetic acid Basic information |
| | 1,1-Cyclohexanediacetic acid Chemical Properties |
| Melting point | 181-185 °C (lit.) | | Boiling point | 297.96°C (rough estimate) | | density | 1.1508 (rough estimate) | | refractive index | 1.4459 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | pK1:3.49 ;pK2:6.96 (25°C) | | color | White to Off-White | | InChI | InChI=1S/C10H16O4/c11-8(12)6-10(7-9(13)14)4-2-1-3-5-10/h1-7H2,(H,11,12)(H,13,14) | | InChIKey | YQPCHPBGAALCRT-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)(CC(O)=O)CCCCC1 | | LogP | 1.2 at 21.9℃ | | CAS DataBase Reference | 4355-11-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-37/39-26-36 | | WGK Germany | 3 | | HS Code | 29172000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,1-Cyclohexanediacetic acid Usage And Synthesis |
| Chemical Properties | WHITE TO OFF-WHITE CRYSTALLINE POWDER | | Uses | 1,1-Cyclohexanediacetic Acid (cas# 4355-11-7) is a compound useful in organic synthesis. |
| | 1,1-Cyclohexanediacetic acid Preparation Products And Raw materials |
| Raw materials | 2,4-Dioxo-3-azaspiro[5.5]undecane-1-carbonitrile-->3-Azaspiro[5.5]undecane-1,5-dicarbonitrile, 3-methyl-2,4-dioxo--->3-Oxaspiro[5.5]undecan-2-one-->ETHYL CYCLOHEXYLIDENEACETATE-->2,4-dioxo-3-azaspiro[5.5]undecane-1,5-dicarbonitrile-->SPIRO[5.5]UNDECANE-2,4-DIONE-->Sulfuric acid | | Preparation Products | 1,1-Cyclohexanediacetic acid mono amide-->Gabapentin Related Compound E-->spiro[3.5]nonan-2-one-->9-methyl-9-azaspiro[5.5]undecane-8,10-dione-->cyclohexane-1,1-diethanol |
|