|
|
| | 5-Methoxytryptamine hydrochloride Basic information |
| | 5-Methoxytryptamine hydrochloride Chemical Properties |
| Melting point | 246 °C | | storage temp. | 2-8°C | | solubility | Methanol | | form | crystalline | | color | white | | Sensitive | Hygroscopic | | Merck | 14,6002 | | BRN | 3717598 | | Stability: | Hygroscopic | | InChI | InChI=1S/C11H14N2O.ClH/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11;/h2-3,6-7,13H,4-5,12H2,1H3;1H | | InChIKey | TXVAYRSEKRMEIF-UHFFFAOYSA-N | | SMILES | NCCC1C2C(=CC=C(OC)C=2)NC=1.[H]Cl | | CAS DataBase Reference | 66-83-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-20/21/22 | | Safety Statements | 36-26 | | WGK Germany | 3 | | RTECS | NL4059000 | | F | 10 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-Methoxytryptamine hydrochloride Usage And Synthesis |
| Chemical Properties | white to beige crystalline powder | | Uses | A closely related compound of the neurotransmitter Melatonin (M215000). | | Uses | A metabolite of Melatonin | | Biochem/physiol Actions | Nonselective serotonin receptor agonist that lacks affinity for the 5-HT3 receptor. | | in vivo | 5-Methoxytryptamine hydrochloride induces a significant hyperglycemia above the dosage of 1 mg/kg in rats[1]. | | IC 50 | 5-HT1 Receptor; 5-HT2 Receptor; 5-HT4 Receptor; 5-HT5 Receptor; 5-HT6 Receptor; 5-HT7 Receptor; Human Endogenous Metabolite |
| | 5-Methoxytryptamine hydrochloride Preparation Products And Raw materials |
|