|
|
| | 3-(Dimethylamino)-1-(2-thienyl)-1-propanol Basic information |
| Product Name: | 3-(Dimethylamino)-1-(2-thienyl)-1-propanol | | Synonyms: | 3-(n,n-dimethylamino)-1-(2-thienyl)propan-1-ol;n,n-dimethyl-3-(2-thienyl)-3-hydroxypropanamine;3-(dimethylamino)-1-(thiophen-2-yl)propan-1-ol;3-(Dimethylamino)-1-(2-thienyl)-1-propanol;Duloxetine Impurity 19;3-(Dimetylamino)-1-(2-thienyl)-1-propanol;2-[3-(Dimethylamino)-1-hydroxypropyl]thiophene;3-(Dimethylamino)-1- | | CAS: | 13636-02-7 | | MF: | C9H15NOS | | MW: | 185.29 | | EINECS: | 603-957-8 | | Product Categories: | Heterocycle-oher series | | Mol File: | 13636-02-7.mol |  |
| | 3-(Dimethylamino)-1-(2-thienyl)-1-propanol Chemical Properties |
| Melting point | 70.0 to 74.0 °C | | Boiling point | 290°C | | density | 1.111 | | Fp | 129°C | | storage temp. | Room temperature. | | solubility | soluble in Methanol | | pka | 13.74±0.20(Predicted) | | form | Crystalline | | color | White to Almost white | | InChI | InChI=1S/C9H15NOS/c1-10(2)6-5-8(11)9-4-3-7-12-9/h3-4,7-8,11H,5-6H2,1-2H3 | | InChIKey | XWCNSHMHUZCRLN-UHFFFAOYSA-N | | SMILES | C1(C(O)CCN(C)C)=CC=CS1 |
| | 3-(Dimethylamino)-1-(2-thienyl)-1-propanol Usage And Synthesis |
| Uses | 3-(Dimethylamino)-1-(2-thienyl)-1-propanol is useful for the preparation of chitosan compounds for optical isomer separating agents. |
| | 3-(Dimethylamino)-1-(2-thienyl)-1-propanol Preparation Products And Raw materials |
|