| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Furosemide Impurity 22
CAS:2309462-39-1
Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Jinan blalong chemical co. LTD
|
| Tel: |
2710913286@.com |
| Email: |
1513643261@qq.com |
| Products Intro: |
Product Name:FurosemideImpurity19
CAS:2309462-39-1
Purity:99% HPLC Package:50G;10G;1G;500MG;100MG
|
| Company Name: |
Shenzhen Roark Pharma-Tec Co., Ltd.
|
| Tel: |
13128912434 |
| Email: |
2880126944@qq.com |
| Products Intro: |
Product Name:Furosemide Impurity 8
CAS:2309462-39-1
Purity:99% HPLC Package:10MG;25MG;50MG;100MG
|
|
| | Benzoic acid, 4-chloro-2-[(2-furanylmethyl)amino]-5-sulfo- Basic information |
| | Benzoic acid, 4-chloro-2-[(2-furanylmethyl)amino]-5-sulfo- Chemical Properties |
| density | 1.661±0.06 g/cm3(Predicted) | | pka | -1.02±0.50(Predicted) | | InChI | InChI=1S/C12H10ClNO6S/c13-9-5-10(14-6-7-2-1-3-20-7)8(12(15)16)4-11(9)21(17,18)19/h1-5,14H,6H2,(H,15,16)(H,17,18,19) | | InChIKey | CZJAAWGPGTUMQR-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(S(O)(=O)=O)=C(Cl)C=C1NCC1=CC=CO1 |
| | Benzoic acid, 4-chloro-2-[(2-furanylmethyl)amino]-5-sulfo- Usage And Synthesis |
| | Benzoic acid, 4-chloro-2-[(2-furanylmethyl)amino]-5-sulfo- Preparation Products And Raw materials |
|